About 5-butylnonan-5-yl-(2-cyclobutyl-1,3-thiazol-5-yl)tin
5-butylnonan-5-yl-(2-cyclobutyl-1,3-thiazol-5-yl)tin (PubChem CID 164852946) has the molecular formula C20H35NSSn
and a molecular weight of 440.29 g/mol. Its IUPAC name is 5-butylnonan-5-yl-(2-cyclobutyl-1,3-thiazol-5-yl)tin.
Molecular Properties
| Compound Name | 5-butylnonan-5-yl-(2-cyclobutyl-1,3-thiazol-5-yl)tin |
| PubChem CID | 164852946 |
| Molecular Formula | C20H35NSSn |
| Molecular Weight | 440.29 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 5-butylnonan-5-yl-(2-cyclobutyl-1,3-thiazol-5-yl)tin |
| SMILES | CCCCC(CCCC)(CCCC)[Sn]c1cnc(C2CCC2)s1 |
| InChI | InChI=1S/C13H27.C7H8NS.Sn/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-2-6(3-1)7-8-4-5-9-7;/h4-12H2,1-3H3;4,6H,1-3H2; |
| InChIKey | SXUKRYUCGHAPQR-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.29 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-butylnonan-5-yl-(2-cyclobutyl-1,3-thiazol-5-yl)tin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butylnonan-5-yl-(2-cyclobutyl-1,3-thiazol-5-yl)tin?
The IUPAC name of 5-butylnonan-5-yl-(2-cyclobutyl-1,3-thiazol-5-yl)tin (CID 164852946) is 5-butylnonan-5-yl-(2-cyclobutyl-1,3-thiazol-5-yl)tin.
What is the SMILES notation for 5-butylnonan-5-yl-(2-cyclobutyl-1,3-thiazol-5-yl)tin?
The canonical SMILES for 5-butylnonan-5-yl-(2-cyclobutyl-1,3-thiazol-5-yl)tin is CCCCC(CCCC)(CCCC)[Sn]c1cnc(C2CCC2)s1.
What is the InChIKey of 5-butylnonan-5-yl-(2-cyclobutyl-1,3-thiazol-5-yl)tin?
The InChIKey is SXUKRYUCGHAPQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27.C7H8NS.Sn/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-2-6(3-1)7-8-4-5-9-7;/h4-12H2,1-3H3;4,6H,1-3H2;.
What are the key properties of 5-butylnonan-5-yl-(2-cyclobutyl-1,3-thiazol-5-yl)tin?
5-butylnonan-5-yl-(2-cyclobutyl-1,3-thiazol-5-yl)tin has a molecular weight of 440.29 g/mol, XLogP of 6.47, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butylnonan-5-yl-(2-cyclobutyl-1,3-thiazol-5-yl)tin is sourced from PubChem (CID 164852946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).