About 5-[(Z)-1,2-bis(2-fluorophenyl)ethenyl]-N-butyl-6-pyridin-2-ylpyridine-2-carboxamide
5-[(Z)-1,2-bis(2-fluorophenyl)ethenyl]-N-butyl-6-pyridin-2-ylpyridine-2-carboxamide (PubChem CID 164853051) has the molecular formula C29H25F2N3O
and a molecular weight of 469.54 g/mol. Its IUPAC name is 5-[(Z)-1,2-bis(2-fluorophenyl)ethenyl]-N-butyl-6-pyridin-2-ylpyridine-2-carboxamide.
Molecular Properties
| Compound Name | 5-[(Z)-1,2-bis(2-fluorophenyl)ethenyl]-N-butyl-6-pyridin-2-ylpyridine-2-carboxamide |
| PubChem CID | 164853051 |
| Molecular Formula | C29H25F2N3O |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 5-[(Z)-1,2-bis(2-fluorophenyl)ethenyl]-N-butyl-6-pyridin-2-ylpyridine-2-carboxamide |
| SMILES | CCCCNC(=O)c1ccc(/C(=C/c2ccccc2F)c2ccccc2F)c(-c2ccccn2)n1 |
| InChI | InChI=1S/C29H25F2N3O/c1-2-3-17-33-29(35)27-16-15-22(28(34-27)26-14-8-9-18-32-26)23(21-11-5-7-13-25(21)31)19-20-10-4-6-12-24(20)30/h4-16,18-19H,2-3,17H2,1H3,(H,33,35)/b23-19+ |
| InChIKey | LSXREEQJPHPXGF-FCDQGJHFSA-N |
| XLogP | 6.54 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(Z)-1,2-bis(2-fluorophenyl)ethenyl]-N-butyl-6-pyridin-2-ylpyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(Z)-1,2-bis(2-fluorophenyl)ethenyl]-N-butyl-6-pyridin-2-ylpyridine-2-carboxamide?
The IUPAC name of 5-[(Z)-1,2-bis(2-fluorophenyl)ethenyl]-N-butyl-6-pyridin-2-ylpyridine-2-carboxamide (CID 164853051) is 5-[(Z)-1,2-bis(2-fluorophenyl)ethenyl]-N-butyl-6-pyridin-2-ylpyridine-2-carboxamide.
What is the SMILES notation for 5-[(Z)-1,2-bis(2-fluorophenyl)ethenyl]-N-butyl-6-pyridin-2-ylpyridine-2-carboxamide?
The canonical SMILES for 5-[(Z)-1,2-bis(2-fluorophenyl)ethenyl]-N-butyl-6-pyridin-2-ylpyridine-2-carboxamide is CCCCNC(=O)c1ccc(/C(=C/c2ccccc2F)c2ccccc2F)c(-c2ccccn2)n1.
What is the InChIKey of 5-[(Z)-1,2-bis(2-fluorophenyl)ethenyl]-N-butyl-6-pyridin-2-ylpyridine-2-carboxamide?
The InChIKey is LSXREEQJPHPXGF-FCDQGJHFSA-N. The full InChI is InChI=1S/C29H25F2N3O/c1-2-3-17-33-29(35)27-16-15-22(28(34-27)26-14-8-9-18-32-26)23(21-11-5-7-13-25(21)31)19-20-10-4-6-12-24(20)30/h4-16,18-19H,2-3,17H2,1H3,(H,33,35)/b23-19+.
What are the key properties of 5-[(Z)-1,2-bis(2-fluorophenyl)ethenyl]-N-butyl-6-pyridin-2-ylpyridine-2-carboxamide?
5-[(Z)-1,2-bis(2-fluorophenyl)ethenyl]-N-butyl-6-pyridin-2-ylpyridine-2-carboxamide has a molecular weight of 469.54 g/mol, XLogP of 6.54, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(Z)-1,2-bis(2-fluorophenyl)ethenyl]-N-butyl-6-pyridin-2-ylpyridine-2-carboxamide is sourced from PubChem (CID 164853051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).