C23H25N5O3 — CID 164853338
N-[(3R)-1-[3-[2-(3,5-dimethoxyphenyl)ethynyl]-1,2-dihydropyrrolo[3,4-d]pyrimidin-4-yl]pyrrolidin-3-yl]prop-2-enamide (PubChem CID 164853338) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is N-[(3R)-1-[3-[2-(3,5-dimethoxyphenyl)ethynyl]-1,2-dihydropyrrolo[3,4-d]pyrimidin-4-yl]pyrrolidin-3-yl]prop-2-enamide.
| Compound Name | N-[(3R)-1-[3-[2-(3,5-dimethoxyphenyl)ethynyl]-1,2-dihydropyrrolo[3,4-d]pyrimidin-4-yl]pyrrolidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 164853338 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | N-[(3R)-1-[3-[2-(3,5-dimethoxyphenyl)ethynyl]-1,2-dihydropyrrolo[3,4-d]pyrimidin-4-yl]pyrrolidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@@H]1CCN(C2=C3C=NC=C3NCN2C#Cc2cc(OC)cc(OC)c2)C1 |
| InChI | InChI=1S/C23H25N5O3/c1-4-22(29)26-17-6-8-27(14-17)23-20-12-24-13-21(20)25-15-28(23)7-5-16-9-18(30-2)11-19(10-16)31-3/h4,9-13,17,25H,1,6,8,14-15H2,2-3H3,(H,26,29)/t17-/m1/s1 |
| InChIKey | UYRLEGLYXVHOHY-QGZVFWFLSA-N |
| XLogP | 1.39 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|