About methyl 2-[4-(6,7-dimethoxyquinoxalin-2-yl)-2-fluorophenyl]acetate
methyl 2-[4-(6,7-dimethoxyquinoxalin-2-yl)-2-fluorophenyl]acetate (PubChem CID 164853359) has the molecular formula C19H17FN2O4
and a molecular weight of 356.35 g/mol. Its IUPAC name is methyl 2-[4-(6,7-dimethoxyquinoxalin-2-yl)-2-fluorophenyl]acetate.
Molecular Properties
| Compound Name | methyl 2-[4-(6,7-dimethoxyquinoxalin-2-yl)-2-fluorophenyl]acetate |
| PubChem CID | 164853359 |
| Molecular Formula | C19H17FN2O4 |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | methyl 2-[4-(6,7-dimethoxyquinoxalin-2-yl)-2-fluorophenyl]acetate |
| SMILES | COC(=O)Cc1ccc(-c2cnc3cc(OC)c(OC)cc3n2)cc1F |
| InChI | InChI=1S/C19H17FN2O4/c1-24-17-8-14-15(9-18(17)25-2)22-16(10-21-14)12-5-4-11(13(20)6-12)7-19(23)26-3/h4-6,8-10H,7H2,1-3H3 |
| InChIKey | LKPQDSNWSFHKAE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[4-(6,7-dimethoxyquinoxalin-2-yl)-2-fluorophenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[4-(6,7-dimethoxyquinoxalin-2-yl)-2-fluorophenyl]acetate?
The IUPAC name of methyl 2-[4-(6,7-dimethoxyquinoxalin-2-yl)-2-fluorophenyl]acetate (CID 164853359) is methyl 2-[4-(6,7-dimethoxyquinoxalin-2-yl)-2-fluorophenyl]acetate.
What is the SMILES notation for methyl 2-[4-(6,7-dimethoxyquinoxalin-2-yl)-2-fluorophenyl]acetate?
The canonical SMILES for methyl 2-[4-(6,7-dimethoxyquinoxalin-2-yl)-2-fluorophenyl]acetate is COC(=O)Cc1ccc(-c2cnc3cc(OC)c(OC)cc3n2)cc1F.
What is the InChIKey of methyl 2-[4-(6,7-dimethoxyquinoxalin-2-yl)-2-fluorophenyl]acetate?
The InChIKey is LKPQDSNWSFHKAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17FN2O4/c1-24-17-8-14-15(9-18(17)25-2)22-16(10-21-14)12-5-4-11(13(20)6-12)7-19(23)26-3/h4-6,8-10H,7H2,1-3H3.
What are the key properties of methyl 2-[4-(6,7-dimethoxyquinoxalin-2-yl)-2-fluorophenyl]acetate?
methyl 2-[4-(6,7-dimethoxyquinoxalin-2-yl)-2-fluorophenyl]acetate has a molecular weight of 356.35 g/mol, XLogP of 3.17, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[4-(6,7-dimethoxyquinoxalin-2-yl)-2-fluorophenyl]acetate is sourced from PubChem (CID 164853359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).