C14H9N3O — CID 164853579
2,4,10-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,11,13,15-heptaen-9-one (PubChem CID 164853579) has the molecular formula C14H9N3O and a molecular weight of 235.25 g/mol. Its IUPAC name is 2,4,10-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,11,13,15-heptaen-9-one.
| Compound Name | 2,4,10-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,11,13,15-heptaen-9-one |
|---|---|
| PubChem CID | 164853579 |
| Molecular Formula | C14H9N3O |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 2,4,10-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,11,13,15-heptaen-9-one |
| SMILES | O=c1c2cccnc2nc2n1-c1ccccc1C2 |
| InChI | InChI=1S/C14H9N3O/c18-14-10-5-3-7-15-13(10)16-12-8-9-4-1-2-6-11(9)17(12)14/h1-7H,8H2 |
| InChIKey | KAFLUKPHEUKGME-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |