C14H8N4O3 — CID 164853588
14-nitro-2,4,10-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,11(16),12,14-heptaen-9-one (PubChem CID 164853588) has the molecular formula C14H8N4O3 and a molecular weight of 280.24 g/mol. Its IUPAC name is 14-nitro-2,4,10-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,11(16),12,14-heptaen-9-one.
| Compound Name | 14-nitro-2,4,10-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,11(16),12,14-heptaen-9-one |
|---|---|
| PubChem CID | 164853588 |
| Molecular Formula | C14H8N4O3 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 14-nitro-2,4,10-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,11(16),12,14-heptaen-9-one |
| SMILES | O=c1c2cccnc2nc2n1-c1ccc([N+](=O)[O-])cc1C2 |
| InChI | InChI=1S/C14H8N4O3/c19-14-10-2-1-5-15-13(10)16-12-7-8-6-9(18(20)21)3-4-11(8)17(12)14/h1-6H,7H2 |
| InChIKey | SFBLWSRAXHVYDU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 90.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|