About methyl (4S)-2'-fluoro-3'-methyl-2-oxospiro[cyclohexane-4,1'-indene]-1-carboxylate
methyl (4S)-2'-fluoro-3'-methyl-2-oxospiro[cyclohexane-4,1'-indene]-1-carboxylate (PubChem CID 164853691) has the molecular formula C17H17FO3
and a molecular weight of 288.32 g/mol. Its IUPAC name is methyl (4S)-2'-fluoro-3'-methyl-2-oxospiro[cyclohexane-4,1'-indene]-1-carboxylate.
Molecular Properties
| Compound Name | methyl (4S)-2'-fluoro-3'-methyl-2-oxospiro[cyclohexane-4,1'-indene]-1-carboxylate |
| PubChem CID | 164853691 |
| Molecular Formula | C17H17FO3 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | methyl (4S)-2'-fluoro-3'-methyl-2-oxospiro[cyclohexane-4,1'-indene]-1-carboxylate |
| SMILES | COC(=O)C1CC[C@@]2(CC1=O)C(F)=C(C)c1ccccc12 |
| InChI | InChI=1S/C17H17FO3/c1-10-11-5-3-4-6-13(11)17(15(10)18)8-7-12(14(19)9-17)16(20)21-2/h3-6,12H,7-9H2,1-2H3/t12?,17-/m0/s1 |
| InChIKey | PICNFOPHORSJIH-TYJDENFWSA-N |
| XLogP | 3.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl (4S)-2'-fluoro-3'-methyl-2-oxospiro[cyclohexane-4,1'-indene]-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (4S)-2'-fluoro-3'-methyl-2-oxospiro[cyclohexane-4,1'-indene]-1-carboxylate?
The IUPAC name of methyl (4S)-2'-fluoro-3'-methyl-2-oxospiro[cyclohexane-4,1'-indene]-1-carboxylate (CID 164853691) is methyl (4S)-2'-fluoro-3'-methyl-2-oxospiro[cyclohexane-4,1'-indene]-1-carboxylate.
What is the SMILES notation for methyl (4S)-2'-fluoro-3'-methyl-2-oxospiro[cyclohexane-4,1'-indene]-1-carboxylate?
The canonical SMILES for methyl (4S)-2'-fluoro-3'-methyl-2-oxospiro[cyclohexane-4,1'-indene]-1-carboxylate is COC(=O)C1CC[C@@]2(CC1=O)C(F)=C(C)c1ccccc12.
What is the InChIKey of methyl (4S)-2'-fluoro-3'-methyl-2-oxospiro[cyclohexane-4,1'-indene]-1-carboxylate?
The InChIKey is PICNFOPHORSJIH-TYJDENFWSA-N. The full InChI is InChI=1S/C17H17FO3/c1-10-11-5-3-4-6-13(11)17(15(10)18)8-7-12(14(19)9-17)16(20)21-2/h3-6,12H,7-9H2,1-2H3/t12?,17-/m0/s1.
What are the key properties of methyl (4S)-2'-fluoro-3'-methyl-2-oxospiro[cyclohexane-4,1'-indene]-1-carboxylate?
methyl (4S)-2'-fluoro-3'-methyl-2-oxospiro[cyclohexane-4,1'-indene]-1-carboxylate has a molecular weight of 288.32 g/mol, XLogP of 3.18, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (4S)-2'-fluoro-3'-methyl-2-oxospiro[cyclohexane-4,1'-indene]-1-carboxylate is sourced from PubChem (CID 164853691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).