About (3R)-2',3'-difluorospiro[cyclohexane-3,1'-indene]-1-one
(3R)-2',3'-difluorospiro[cyclohexane-3,1'-indene]-1-one (PubChem CID 164853699) has the molecular formula C14H12F2O
and a molecular weight of 234.25 g/mol. Its IUPAC name is (3R)-2',3'-difluorospiro[cyclohexane-3,1'-indene]-1-one.
Molecular Properties
| Compound Name | (3R)-2',3'-difluorospiro[cyclohexane-3,1'-indene]-1-one |
| PubChem CID | 164853699 |
| Molecular Formula | C14H12F2O |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | (3R)-2',3'-difluorospiro[cyclohexane-3,1'-indene]-1-one |
| SMILES | O=C1CCC[C@]2(C1)C(F)=C(F)c1ccccc12 |
| InChI | InChI=1S/C14H12F2O/c15-12-10-5-1-2-6-11(10)14(13(12)16)7-3-4-9(17)8-14/h1-2,5-6H,3-4,7-8H2/t14-/m1/s1 |
| InChIKey | QSHQEXDWHMSKMQ-CQSZACIVSA-N |
| XLogP | 3.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3R)-2',3'-difluorospiro[cyclohexane-3,1'-indene]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-2',3'-difluorospiro[cyclohexane-3,1'-indene]-1-one?
The IUPAC name of (3R)-2',3'-difluorospiro[cyclohexane-3,1'-indene]-1-one (CID 164853699) is (3R)-2',3'-difluorospiro[cyclohexane-3,1'-indene]-1-one.
What is the SMILES notation for (3R)-2',3'-difluorospiro[cyclohexane-3,1'-indene]-1-one?
The canonical SMILES for (3R)-2',3'-difluorospiro[cyclohexane-3,1'-indene]-1-one is O=C1CCC[C@]2(C1)C(F)=C(F)c1ccccc12.
What is the InChIKey of (3R)-2',3'-difluorospiro[cyclohexane-3,1'-indene]-1-one?
The InChIKey is QSHQEXDWHMSKMQ-CQSZACIVSA-N. The full InChI is InChI=1S/C14H12F2O/c15-12-10-5-1-2-6-11(10)14(13(12)16)7-3-4-9(17)8-14/h1-2,5-6H,3-4,7-8H2/t14-/m1/s1.
What are the key properties of (3R)-2',3'-difluorospiro[cyclohexane-3,1'-indene]-1-one?
(3R)-2',3'-difluorospiro[cyclohexane-3,1'-indene]-1-one has a molecular weight of 234.25 g/mol, XLogP of 3.69, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-2',3'-difluorospiro[cyclohexane-3,1'-indene]-1-one is sourced from PubChem (CID 164853699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).