About 2-propan-2-ylpenta-1,4-dien-1-one
2-propan-2-ylpenta-1,4-dien-1-one (PubChem CID 164853816) has the molecular formula C8H12O
and a molecular weight of 124.18 g/mol. Its IUPAC name is 2-propan-2-ylpenta-1,4-dien-1-one.
Molecular Properties
| Compound Name | 2-propan-2-ylpenta-1,4-dien-1-one |
| PubChem CID | 164853816 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | 2-propan-2-ylpenta-1,4-dien-1-one |
| SMILES | C=CCC(=C=O)C(C)C |
| InChI | InChI=1S/C8H12O/c1-4-5-8(6-9)7(2)3/h4,7H,1,5H2,2-3H3 |
| InChIKey | LYFHRXXBQDWSHY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze 2-propan-2-ylpenta-1,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-ylpenta-1,4-dien-1-one?
The IUPAC name of 2-propan-2-ylpenta-1,4-dien-1-one (CID 164853816) is 2-propan-2-ylpenta-1,4-dien-1-one.
What is the SMILES notation for 2-propan-2-ylpenta-1,4-dien-1-one?
The canonical SMILES for 2-propan-2-ylpenta-1,4-dien-1-one is C=CCC(=C=O)C(C)C.
What is the InChIKey of 2-propan-2-ylpenta-1,4-dien-1-one?
The InChIKey is LYFHRXXBQDWSHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O/c1-4-5-8(6-9)7(2)3/h4,7H,1,5H2,2-3H3.
What are the key properties of 2-propan-2-ylpenta-1,4-dien-1-one?
2-propan-2-ylpenta-1,4-dien-1-one has a molecular weight of 124.18 g/mol, XLogP of 1.98, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-ylpenta-1,4-dien-1-one is sourced from PubChem (CID 164853816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).