C26H29Cl2F4N5 — CID 164855363
(3R)-N-[3,5-dichloro-4-[(6S,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]phenyl]-1-(3-fluoropropyl)pyrrolidin-3-amine (PubChem CID 164855363) has the molecular formula C26H29Cl2F4N5 and a molecular weight of 558.45 g/mol. Its IUPAC name is (3R)-N-[3,5-dichloro-4-[(6S,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]phenyl]-1-(3-fluoropropyl)pyrrolidin-3-amine.
| Compound Name | (3R)-N-[3,5-dichloro-4-[(6S,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]phenyl]-1-(3-fluoropropyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 164855363 |
| Molecular Formula | C26H29Cl2F4N5 |
| Molecular Weight | 558.45 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | (3R)-N-[3,5-dichloro-4-[(6S,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]phenyl]-1-(3-fluoropropyl)pyrrolidin-3-amine |
| SMILES | C[C@@H]1Cc2c(ccc3[nH]ncc23)[C@@H](c2c(Cl)cc(N[C@@H]3CCN(CCCF)C3)cc2Cl)N1CC(F)(F)F |
| InChI | InChI=1S/C26H29Cl2F4N5/c1-15-9-19-18(3-4-23-20(19)12-33-35-23)25(37(15)14-26(30,31)32)24-21(27)10-17(11-22(24)28)34-16-5-8-36(13-16)7-2-6-29/h3-4,10-12,15-16,25,34H,2,5-9,13-14H2,1H3,(H,33,35)/t15-,16-,25+/m1/s1 |
| InChIKey | OFRPJDJODHPJHR-RKPUJPDHSA-N |
| XLogP | 6.61 |
| TPSA | 47.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.45 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |