About 2-[2-[2,6-di(propan-2-yl)-4-pyridinyl]anilino]benzoic acid
2-[2-[2,6-di(propan-2-yl)-4-pyridinyl]anilino]benzoic acid (PubChem CID 164855436) has the molecular formula C24H26N2O2
and a molecular weight of 374.48 g/mol. Its IUPAC name is 2-[2-[2,6-di(propan-2-yl)-4-pyridinyl]anilino]benzoic acid.
Molecular Properties
| Compound Name | 2-[2-[2,6-di(propan-2-yl)-4-pyridinyl]anilino]benzoic acid |
| PubChem CID | 164855436 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 2-[2-[2,6-di(propan-2-yl)-4-pyridinyl]anilino]benzoic acid |
| SMILES | CC(C)c1cc(-c2ccccc2Nc2ccccc2C(=O)O)cc(C(C)C)n1 |
| InChI | InChI=1S/C24H26N2O2/c1-15(2)22-13-17(14-23(26-22)16(3)4)18-9-5-7-11-20(18)25-21-12-8-6-10-19(21)24(27)28/h5-16,25H,1-4H3,(H,27,28) |
| InChIKey | LLMJSYXZIZBJLM-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-[2,6-di(propan-2-yl)-4-pyridinyl]anilino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2,6-di(propan-2-yl)-4-pyridinyl]anilino]benzoic acid?
The IUPAC name of 2-[2-[2,6-di(propan-2-yl)-4-pyridinyl]anilino]benzoic acid (CID 164855436) is 2-[2-[2,6-di(propan-2-yl)-4-pyridinyl]anilino]benzoic acid.
What is the SMILES notation for 2-[2-[2,6-di(propan-2-yl)-4-pyridinyl]anilino]benzoic acid?
The canonical SMILES for 2-[2-[2,6-di(propan-2-yl)-4-pyridinyl]anilino]benzoic acid is CC(C)c1cc(-c2ccccc2Nc2ccccc2C(=O)O)cc(C(C)C)n1.
What is the InChIKey of 2-[2-[2,6-di(propan-2-yl)-4-pyridinyl]anilino]benzoic acid?
The InChIKey is LLMJSYXZIZBJLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N2O2/c1-15(2)22-13-17(14-23(26-22)16(3)4)18-9-5-7-11-20(18)25-21-12-8-6-10-19(21)24(27)28/h5-16,25H,1-4H3,(H,27,28).
What are the key properties of 2-[2-[2,6-di(propan-2-yl)-4-pyridinyl]anilino]benzoic acid?
2-[2-[2,6-di(propan-2-yl)-4-pyridinyl]anilino]benzoic acid has a molecular weight of 374.48 g/mol, XLogP of 6.44, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2,6-di(propan-2-yl)-4-pyridinyl]anilino]benzoic acid is sourced from PubChem (CID 164855436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).