C20H28N6O2 — CID 164855590
2-butyl-4-N-(2-methoxyethyl)-3-[(4-methoxyphenyl)methyl]imidazo[4,5-d]pyridazine-4,7-diamine (PubChem CID 164855590) has the molecular formula C20H28N6O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-butyl-4-N-(2-methoxyethyl)-3-[(4-methoxyphenyl)methyl]imidazo[4,5-d]pyridazine-4,7-diamine.
| Compound Name | 2-butyl-4-N-(2-methoxyethyl)-3-[(4-methoxyphenyl)methyl]imidazo[4,5-d]pyridazine-4,7-diamine |
|---|---|
| PubChem CID | 164855590 |
| Molecular Formula | C20H28N6O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 2-butyl-4-N-(2-methoxyethyl)-3-[(4-methoxyphenyl)methyl]imidazo[4,5-d]pyridazine-4,7-diamine |
| SMILES | CCCCc1nc2c(N)nnc(NCCOC)c2n1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C20H28N6O2/c1-4-5-6-16-23-17-18(20(22-11-12-27-2)25-24-19(17)21)26(16)13-14-7-9-15(28-3)10-8-14/h7-10H,4-6,11-13H2,1-3H3,(H2,21,24)(H,22,25) |
| InChIKey | ASFCLNFDWIUHPZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|