C24H22FN3O2 — CID 164856404
1-[1-[4-(2-cyclopropylethynyl)-3-fluorophenyl]ethyl]-6-methyl-4-(pyrimidin-2-ylmethoxy)pyridin-2-one (PubChem CID 164856404) has the molecular formula C24H22FN3O2 and a molecular weight of 403.46 g/mol. Its IUPAC name is 1-[1-[4-(2-cyclopropylethynyl)-3-fluorophenyl]ethyl]-6-methyl-4-(pyrimidin-2-ylmethoxy)pyridin-2-one.
| Compound Name | 1-[1-[4-(2-cyclopropylethynyl)-3-fluorophenyl]ethyl]-6-methyl-4-(pyrimidin-2-ylmethoxy)pyridin-2-one |
|---|---|
| PubChem CID | 164856404 |
| Molecular Formula | C24H22FN3O2 |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 1-[1-[4-(2-cyclopropylethynyl)-3-fluorophenyl]ethyl]-6-methyl-4-(pyrimidin-2-ylmethoxy)pyridin-2-one |
| SMILES | Cc1cc(OCc2ncccn2)cc(=O)n1C(C)c1ccc(C#CC2CC2)c(F)c1 |
| InChI | InChI=1S/C24H22FN3O2/c1-16-12-21(30-15-23-26-10-3-11-27-23)14-24(29)28(16)17(2)20-9-8-19(22(25)13-20)7-6-18-4-5-18/h3,8-14,17-18H,4-5,15H2,1-2H3 |
| InChIKey | QIGUGTAOZTZNIA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|