C23H29F2N5O — CID 164856901
5-[3-(4,4-difluoropiperidin-1-yl)prop-1-ynyl]-3-ethyl-2-[1-(oxan-2-ylmethyl)triazol-4-yl]pyridine (PubChem CID 164856901) has the molecular formula C23H29F2N5O and a molecular weight of 429.52 g/mol. Its IUPAC name is 5-[3-(4,4-difluoropiperidin-1-yl)prop-1-ynyl]-3-ethyl-2-[1-(oxan-2-ylmethyl)triazol-4-yl]pyridine.
| Compound Name | 5-[3-(4,4-difluoropiperidin-1-yl)prop-1-ynyl]-3-ethyl-2-[1-(oxan-2-ylmethyl)triazol-4-yl]pyridine |
|---|---|
| PubChem CID | 164856901 |
| Molecular Formula | C23H29F2N5O |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 5-[3-(4,4-difluoropiperidin-1-yl)prop-1-ynyl]-3-ethyl-2-[1-(oxan-2-ylmethyl)triazol-4-yl]pyridine |
| SMILES | CCc1cc(C#CCN2CCC(F)(F)CC2)cnc1-c1cn(CC2CCCCO2)nn1 |
| InChI | InChI=1S/C23H29F2N5O/c1-2-19-14-18(6-5-10-29-11-8-23(24,25)9-12-29)15-26-22(19)21-17-30(28-27-21)16-20-7-3-4-13-31-20/h14-15,17,20H,2-4,7-13,16H2,1H3 |
| InChIKey | QMSGOEWXMSVKND-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|