C11H18N2O2 — CID 164857139
(Z)-1-N-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]but-1-en-3-yne-1,2-diamine (PubChem CID 164857139) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is (Z)-1-N-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]but-1-en-3-yne-1,2-diamine.
| Compound Name | (Z)-1-N-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]but-1-en-3-yne-1,2-diamine |
|---|---|
| PubChem CID | 164857139 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | (Z)-1-N-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]but-1-en-3-yne-1,2-diamine |
| SMILES | C#C/C(N)=C/NCC1OCC(C)(C)CO1 |
| InChI | InChI=1S/C11H18N2O2/c1-4-9(12)5-13-6-10-14-7-11(2,3)8-15-10/h1,5,10,13H,6-8,12H2,2-3H3/b9-5- |
| InChIKey | VSOFZMJFALDJQG-UITAMQMPSA-N |
| XLogP | 0.41 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|