C20H26N4O2 — CID 164857618
(2Z)-2-[5-(2-cyclopropylethynyl)-3-ethyl-2-pyridinyl]-N-[(4,4-dimethyl-1,3-dioxolan-2-yl)methyl]-2-hydrazinylideneethanimine (PubChem CID 164857618) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is (2Z)-2-[5-(2-cyclopropylethynyl)-3-ethyl-2-pyridinyl]-N-[(4,4-dimethyl-1,3-dioxolan-2-yl)methyl]-2-hydrazinylideneethanimine.
| Compound Name | (2Z)-2-[5-(2-cyclopropylethynyl)-3-ethyl-2-pyridinyl]-N-[(4,4-dimethyl-1,3-dioxolan-2-yl)methyl]-2-hydrazinylideneethanimine |
|---|---|
| PubChem CID | 164857618 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | (2Z)-2-[5-(2-cyclopropylethynyl)-3-ethyl-2-pyridinyl]-N-[(4,4-dimethyl-1,3-dioxolan-2-yl)methyl]-2-hydrazinylideneethanimine |
| SMILES | CCc1cc(C#CC2CC2)cnc1C(/C=N/CC1OCC(C)(C)O1)=N/N |
| InChI | InChI=1S/C20H26N4O2/c1-4-16-9-15(8-7-14-5-6-14)10-23-19(16)17(24-21)11-22-12-18-25-13-20(2,3)26-18/h9-11,14,18H,4-6,12-13,21H2,1-3H3/b22-11+,24-17+ |
| InChIKey | AMZWJVKOUJYVDM-MGZHUYFUSA-N |
| XLogP | 2.29 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|