C20H24N4O2 — CID 164857990
5-(2-cyclopropylethynyl)-2-[1-(1,3-dioxan-2-ylmethyl)triazol-4-yl]-N,N-dimethylaniline (PubChem CID 164857990) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 5-(2-cyclopropylethynyl)-2-[1-(1,3-dioxan-2-ylmethyl)triazol-4-yl]-N,N-dimethylaniline.
| Compound Name | 5-(2-cyclopropylethynyl)-2-[1-(1,3-dioxan-2-ylmethyl)triazol-4-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 164857990 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 5-(2-cyclopropylethynyl)-2-[1-(1,3-dioxan-2-ylmethyl)triazol-4-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1cc(C#CC2CC2)ccc1-c1cn(CC2OCCCO2)nn1 |
| InChI | InChI=1S/C20H24N4O2/c1-23(2)19-12-16(7-6-15-4-5-15)8-9-17(19)18-13-24(22-21-18)14-20-25-10-3-11-26-20/h8-9,12-13,15,20H,3-5,10-11,14H2,1-2H3 |
| InChIKey | NDSQOTQMWVZLDE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|