C20H24N4O2 — CID 164858354
5-(2-cyclopropylethynyl)-2-[1-[(2,2-dimethyl-1,3-dioxan-5-yl)methyl]triazol-4-yl]-3-methylpyridine (PubChem CID 164858354) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 5-(2-cyclopropylethynyl)-2-[1-[(2,2-dimethyl-1,3-dioxan-5-yl)methyl]triazol-4-yl]-3-methylpyridine.
| Compound Name | 5-(2-cyclopropylethynyl)-2-[1-[(2,2-dimethyl-1,3-dioxan-5-yl)methyl]triazol-4-yl]-3-methylpyridine |
|---|---|
| PubChem CID | 164858354 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 5-(2-cyclopropylethynyl)-2-[1-[(2,2-dimethyl-1,3-dioxan-5-yl)methyl]triazol-4-yl]-3-methylpyridine |
| SMILES | Cc1cc(C#CC2CC2)cnc1-c1cn(CC2COC(C)(C)OC2)nn1 |
| InChI | InChI=1S/C20H24N4O2/c1-14-8-16(7-6-15-4-5-15)9-21-19(14)18-11-24(23-22-18)10-17-12-25-20(2,3)26-13-17/h8-9,11,15,17H,4-5,10,12-13H2,1-3H3 |
| InChIKey | BNWSCAOFNPTWBE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|