C19H30N4O — CID 164858479
(2Z)-2-[2-cyclopropyloxy-4-(3,3-dimethylazetidin-1-yl)phenyl]-2-hydrazinylidene-N-methylethanimine;ethane (PubChem CID 164858479) has the molecular formula C19H30N4O and a molecular weight of 330.48 g/mol. Its IUPAC name is (2Z)-2-[2-cyclopropyloxy-4-(3,3-dimethylazetidin-1-yl)phenyl]-2-hydrazinylidene-N-methylethanimine;ethane.
| Compound Name | (2Z)-2-[2-cyclopropyloxy-4-(3,3-dimethylazetidin-1-yl)phenyl]-2-hydrazinylidene-N-methylethanimine;ethane |
|---|---|
| PubChem CID | 164858479 |
| Molecular Formula | C19H30N4O |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | (2Z)-2-[2-cyclopropyloxy-4-(3,3-dimethylazetidin-1-yl)phenyl]-2-hydrazinylidene-N-methylethanimine;ethane |
| SMILES | C/N=C/C(=N\N)c1ccc(N2CC(C)(C)C2)cc1OC1CC1.CC |
| InChI | InChI=1S/C17H24N4O.C2H6/c1-17(2)10-21(11-17)12-4-7-14(15(20-18)9-19-3)16(8-12)22-13-5-6-13;1-2/h4,7-9,13H,5-6,10-11,18H2,1-3H3;1-2H3/b19-9+,20-15+; |
| InChIKey | ATELXQYNQMSTDE-HKUFFGAVSA-N |
| XLogP | 3.46 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|