C9H12F3N3OS — CID 164858857
2-(trifluoromethylsulfanyloxy)-4,5,6,7,8,9-hexahydropyrazolo[1,5-a][1,4]diazocine (PubChem CID 164858857) has the molecular formula C9H12F3N3OS and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-(trifluoromethylsulfanyloxy)-4,5,6,7,8,9-hexahydropyrazolo[1,5-a][1,4]diazocine.
| Compound Name | 2-(trifluoromethylsulfanyloxy)-4,5,6,7,8,9-hexahydropyrazolo[1,5-a][1,4]diazocine |
|---|---|
| PubChem CID | 164858857 |
| Molecular Formula | C9H12F3N3OS |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 2-(trifluoromethylsulfanyloxy)-4,5,6,7,8,9-hexahydropyrazolo[1,5-a][1,4]diazocine |
| SMILES | FC(F)(F)SOc1cc2n(n1)CCCCNC2 |
| InChI | InChI=1S/C9H12F3N3OS/c10-9(11,12)17-16-8-5-7-6-13-3-1-2-4-15(7)14-8/h5,13H,1-4,6H2 |
| InChIKey | DMUJIXCDBHWNSM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|