C12H21NO2S — CID 164860197
ethane;(3E,5Z)-N-ethylocta-1,3,5,7-tetraene-4-sulfonamide (PubChem CID 164860197) has the molecular formula C12H21NO2S and a molecular weight of 243.37 g/mol. Its IUPAC name is ethane;(3E,5Z)-N-ethylocta-1,3,5,7-tetraene-4-sulfonamide.
| Compound Name | ethane;(3E,5Z)-N-ethylocta-1,3,5,7-tetraene-4-sulfonamide |
|---|---|
| PubChem CID | 164860197 |
| Molecular Formula | C12H21NO2S |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | ethane;(3E,5Z)-N-ethylocta-1,3,5,7-tetraene-4-sulfonamide |
| SMILES | C=C/C=C\C(=C/C=C)S(=O)(=O)NCC.CC |
| InChI | InChI=1S/C10H15NO2S.C2H6/c1-4-7-9-10(8-5-2)14(12,13)11-6-3;1-2/h4-5,7-9,11H,1-2,6H2,3H3;1-2H3/b9-7-,10-8+; |
| InChIKey | UWURDVZYEHLNMC-OMINISFASA-N |
| XLogP | 2.76 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|