C28H25F2N7O — CID 164860238
[(1S,6R,7R)-7-(2,4-difluorophenyl)-3-[3-(8-methoxyquinolin-5-yl)-2H-pyrazolo[3,4-b]pyrazin-6-yl]-3-azabicyclo[4.1.0]heptan-7-yl]methanamine (PubChem CID 164860238) has the molecular formula C28H25F2N7O and a molecular weight of 513.55 g/mol. Its IUPAC name is [(1S,6R,7R)-7-(2,4-difluorophenyl)-3-[3-(8-methoxyquinolin-5-yl)-2H-pyrazolo[3,4-b]pyrazin-6-yl]-3-azabicyclo[4.1.0]heptan-7-yl]methanamine.
| Compound Name | [(1S,6R,7R)-7-(2,4-difluorophenyl)-3-[3-(8-methoxyquinolin-5-yl)-2H-pyrazolo[3,4-b]pyrazin-6-yl]-3-azabicyclo[4.1.0]heptan-7-yl]methanamine |
|---|---|
| PubChem CID | 164860238 |
| Molecular Formula | C28H25F2N7O |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | [(1S,6R,7R)-7-(2,4-difluorophenyl)-3-[3-(8-methoxyquinolin-5-yl)-2H-pyrazolo[3,4-b]pyrazin-6-yl]-3-azabicyclo[4.1.0]heptan-7-yl]methanamine |
| SMILES | COc1ccc(-c2[nH]nc3nc(N4CC[C@@H]5[C@H](C4)[C@@]5(CN)c4ccc(F)cc4F)cnc23)c2cccnc12 |
| InChI | InChI=1S/C28H25F2N7O/c1-38-22-7-5-17(16-3-2-9-32-24(16)22)25-26-27(36-35-25)34-23(12-33-26)37-10-8-18-20(13-37)28(18,14-31)19-6-4-15(29)11-21(19)30/h2-7,9,11-12,18,20H,8,10,13-14,31H2,1H3,(H,34,35,36)/t18-,20+,28-/m1/s1 |
| InChIKey | QEEXCCQWUPQHLC-JTAARSKYSA-N |
| XLogP | 4.21 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |