About 5-bromo-4-chloro-1,2-dimethylbenzimidazole
5-bromo-4-chloro-1,2-dimethylbenzimidazole (PubChem CID 164860478) has the molecular formula C9H8BrClN2
and a molecular weight of 259.53 g/mol. Its IUPAC name is 5-bromo-4-chloro-1,2-dimethylbenzimidazole.
Molecular Properties
| Compound Name | 5-bromo-4-chloro-1,2-dimethylbenzimidazole |
| PubChem CID | 164860478 |
| Molecular Formula | C9H8BrClN2 |
| Molecular Weight | 259.53 g/mol |
| Exact Mass | 257.96 |
| IUPAC Name | 5-bromo-4-chloro-1,2-dimethylbenzimidazole |
| SMILES | Cc1nc2c(Cl)c(Br)ccc2n1C |
| InChI | InChI=1S/C9H8BrClN2/c1-5-12-9-7(13(5)2)4-3-6(10)8(9)11/h3-4H,1-2H3 |
| InChIKey | LLOCLZVUQHUHJO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-4-chloro-1,2-dimethylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-chloro-1,2-dimethylbenzimidazole?
The IUPAC name of 5-bromo-4-chloro-1,2-dimethylbenzimidazole (CID 164860478) is 5-bromo-4-chloro-1,2-dimethylbenzimidazole.
What is the SMILES notation for 5-bromo-4-chloro-1,2-dimethylbenzimidazole?
The canonical SMILES for 5-bromo-4-chloro-1,2-dimethylbenzimidazole is Cc1nc2c(Cl)c(Br)ccc2n1C.
What is the InChIKey of 5-bromo-4-chloro-1,2-dimethylbenzimidazole?
The InChIKey is LLOCLZVUQHUHJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrClN2/c1-5-12-9-7(13(5)2)4-3-6(10)8(9)11/h3-4H,1-2H3.
What are the key properties of 5-bromo-4-chloro-1,2-dimethylbenzimidazole?
5-bromo-4-chloro-1,2-dimethylbenzimidazole has a molecular weight of 259.53 g/mol, XLogP of 3.30, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-chloro-1,2-dimethylbenzimidazole is sourced from PubChem (CID 164860478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).