C30H28ClF3N6O — CID 164860544
4-[4-[6-[(1S,6R,7R)-7-(aminomethyl)-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-3-yl]-2H-pyrazolo[3,4-b]pyrazin-3-yl]-3-chlorophenyl]-2,6-difluorocyclohex-3-en-1-ol (PubChem CID 164860544) has the molecular formula C30H28ClF3N6O and a molecular weight of 581.04 g/mol. Its IUPAC name is 4-[4-[6-[(1S,6R,7R)-7-(aminomethyl)-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-3-yl]-2H-pyrazolo[3,4-b]pyrazin-3-yl]-3-chlorophenyl]-2,6-difluorocyclohex-3-en-1-ol.
| Compound Name | 4-[4-[6-[(1S,6R,7R)-7-(aminomethyl)-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-3-yl]-2H-pyrazolo[3,4-b]pyrazin-3-yl]-3-chlorophenyl]-2,6-difluorocyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 164860544 |
| Molecular Formula | C30H28ClF3N6O |
| Molecular Weight | 581.04 g/mol |
| Exact Mass | 580.20 |
| IUPAC Name | 4-[4-[6-[(1S,6R,7R)-7-(aminomethyl)-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-3-yl]-2H-pyrazolo[3,4-b]pyrazin-3-yl]-3-chlorophenyl]-2,6-difluorocyclohex-3-en-1-ol |
| SMILES | NC[C@]1(c2ccccc2F)[C@@H]2CCN(c3cnc4c(-c5ccc(C6=CC(F)C(O)C(F)C6)cc5Cl)[nH]nc4n3)C[C@@H]21 |
| InChI | InChI=1S/C30H28ClF3N6O/c31-21-9-15(16-10-23(33)28(41)24(34)11-16)5-6-17(21)26-27-29(39-38-26)37-25(12-36-27)40-8-7-18-20(13-40)30(18,14-35)19-3-1-2-4-22(19)32/h1-6,9-10,12,18,20,23-24,28,41H,7-8,11,13-14,35H2,(H,37,38,39)/t18-,20+,23?,24?,28?,30-/m1/s1 |
| InChIKey | SGKVZQSYSJFSMQ-CDWVGAMLSA-N |
| XLogP | 4.99 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.04 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |