C14H24ClN3O3Pb+ — CID 164860654
CID 164860654 (PubChem CID 164860654) has the molecular formula C14H24ClN3O3Pb+ and a molecular weight of 525.02 g/mol.
| Compound Name | CID 164860654 |
|---|---|
| PubChem CID | 164860654 |
| Molecular Formula | C14H24ClN3O3Pb+ |
| Molecular Weight | 525.02 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | — |
| SMILES | CCl.Cc1cc(C2(CNC(=O)OC[Pb])C[NH2+]CCC2C)on1 |
| InChI | InChI=1S/C13H20N3O3.CH3Cl.Pb/c1-9-4-5-14-7-13(9,8-15-12(17)18-3)11-6-10(2)16-19-11;1-2;/h6,9,14H,3-5,7-8H2,1-2H3,(H,15,17);1H3;/p+1 |
| InChIKey | WUWIIBBBUBYUHP-UHFFFAOYSA-O |
| XLogP | 0.53 |
| TPSA | 80.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.02 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|