C26H24FN7O — CID 164860853
5-[6-[(1S,6R,7R)-7-(aminomethyl)-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-3-yl]-2H-pyrazolo[3,4-b]pyrazin-3-yl]-2,3-dihydroisoindol-1-one (PubChem CID 164860853) has the molecular formula C26H24FN7O and a molecular weight of 469.52 g/mol. Its IUPAC name is 5-[6-[(1S,6R,7R)-7-(aminomethyl)-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-3-yl]-2H-pyrazolo[3,4-b]pyrazin-3-yl]-2,3-dihydroisoindol-1-one.
| Compound Name | 5-[6-[(1S,6R,7R)-7-(aminomethyl)-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-3-yl]-2H-pyrazolo[3,4-b]pyrazin-3-yl]-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 164860853 |
| Molecular Formula | C26H24FN7O |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 5-[6-[(1S,6R,7R)-7-(aminomethyl)-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-3-yl]-2H-pyrazolo[3,4-b]pyrazin-3-yl]-2,3-dihydroisoindol-1-one |
| SMILES | NC[C@]1(c2ccccc2F)[C@@H]2CCN(c3cnc4c(-c5ccc6c(c5)CNC6=O)[nH]nc4n3)C[C@@H]21 |
| InChI | InChI=1S/C26H24FN7O/c27-20-4-2-1-3-18(20)26(13-28)17-7-8-34(12-19(17)26)21-11-29-23-22(32-33-24(23)31-21)14-5-6-16-15(9-14)10-30-25(16)35/h1-6,9,11,17,19H,7-8,10,12-13,28H2,(H,30,35)(H,31,32,33)/t17-,19+,26-/m1/s1 |
| InChIKey | ACXVRVLVGZREHZ-QKSGUBBWSA-N |
| XLogP | 2.76 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |