C30H31NO5 — CID 164861171
8-[4-[4-[ethyl-[(2-methoxyphenyl)methyl]amino]butyl]phenyl]-[1,3]dioxolo[4,5-h]chromen-6-one (PubChem CID 164861171) has the molecular formula C30H31NO5 and a molecular weight of 485.58 g/mol. Its IUPAC name is 8-[4-[4-[ethyl-[(2-methoxyphenyl)methyl]amino]butyl]phenyl]-[1,3]dioxolo[4,5-h]chromen-6-one.
| Compound Name | 8-[4-[4-[ethyl-[(2-methoxyphenyl)methyl]amino]butyl]phenyl]-[1,3]dioxolo[4,5-h]chromen-6-one |
|---|---|
| PubChem CID | 164861171 |
| Molecular Formula | C30H31NO5 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 8-[4-[4-[ethyl-[(2-methoxyphenyl)methyl]amino]butyl]phenyl]-[1,3]dioxolo[4,5-h]chromen-6-one |
| SMILES | CCN(CCCCc1ccc(-c2cc(=O)c3ccc4c(c3o2)OCO4)cc1)Cc1ccccc1OC |
| InChI | InChI=1S/C30H31NO5/c1-3-31(19-23-9-4-5-10-26(23)33-2)17-7-6-8-21-11-13-22(14-12-21)28-18-25(32)24-15-16-27-30(29(24)36-28)35-20-34-27/h4-5,9-16,18H,3,6-8,17,19-20H2,1-2H3 |
| InChIKey | QPCOBHINQUTYRI-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 61.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|