C40H45N3O5 — CID 164861365
8-methoxy-2-[4-[methyl-[methyl(3-piperidin-1-ylpropyl)amino]amino]phenyl]-5,7-bis(phenylmethoxy)chromen-4-one (PubChem CID 164861365) has the molecular formula C40H45N3O5 and a molecular weight of 647.82 g/mol. Its IUPAC name is 8-methoxy-2-[4-[methyl-[methyl(3-piperidin-1-ylpropyl)amino]amino]phenyl]-5,7-bis(phenylmethoxy)chromen-4-one.
| Compound Name | 8-methoxy-2-[4-[methyl-[methyl(3-piperidin-1-ylpropyl)amino]amino]phenyl]-5,7-bis(phenylmethoxy)chromen-4-one |
|---|---|
| PubChem CID | 164861365 |
| Molecular Formula | C40H45N3O5 |
| Molecular Weight | 647.82 g/mol |
| Exact Mass | 647.34 |
| IUPAC Name | 8-methoxy-2-[4-[methyl-[methyl(3-piperidin-1-ylpropyl)amino]amino]phenyl]-5,7-bis(phenylmethoxy)chromen-4-one |
| SMILES | COc1c(OCc2ccccc2)cc(OCc2ccccc2)c2c(=O)cc(-c3ccc(N(C)N(C)CCCN4CCCCC4)cc3)oc12 |
| InChI | InChI=1S/C40H45N3O5/c1-41(22-13-25-43-23-11-6-12-24-43)42(2)33-20-18-32(19-21-33)35-26-34(44)38-36(46-28-30-14-7-4-8-15-30)27-37(39(45-3)40(38)48-35)47-29-31-16-9-5-10-17-31/h4-5,7-10,14-21,26-27H,6,11-13,22-25,28-29H2,1-3H3 |
| InChIKey | AHZDARBVQHKAPI-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 67.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.82 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|