C14H9ClFN7O — CID 164861693
4-[1-[(6-chloro-3-pyridinyl)methyl]-6-fluoroimidazo[4,5-b]pyridin-2-yl]-1,2,5-oxadiazol-3-amine (PubChem CID 164861693) has the molecular formula C14H9ClFN7O and a molecular weight of 345.73 g/mol. Its IUPAC name is 4-[1-[(6-chloro-3-pyridinyl)methyl]-6-fluoroimidazo[4,5-b]pyridin-2-yl]-1,2,5-oxadiazol-3-amine.
| Compound Name | 4-[1-[(6-chloro-3-pyridinyl)methyl]-6-fluoroimidazo[4,5-b]pyridin-2-yl]-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 164861693 |
| Molecular Formula | C14H9ClFN7O |
| Molecular Weight | 345.73 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 4-[1-[(6-chloro-3-pyridinyl)methyl]-6-fluoroimidazo[4,5-b]pyridin-2-yl]-1,2,5-oxadiazol-3-amine |
| SMILES | Nc1nonc1-c1nc2ncc(F)cc2n1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C14H9ClFN7O/c15-10-2-1-7(4-18-10)6-23-9-3-8(16)5-19-13(9)20-14(23)11-12(17)22-24-21-11/h1-5H,6H2,(H2,17,22) |
| InChIKey | KHFJZKWSRCOEME-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 108.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.73 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|