C7H17FN2 — CID 164861996
(2R)-N'-fluoro-N,N,N',2-tetramethylpropane-1,3-diamine (PubChem CID 164861996) has the molecular formula C7H17FN2 and a molecular weight of 148.22 g/mol. Its IUPAC name is (2R)-N'-fluoro-N,N,N',2-tetramethylpropane-1,3-diamine.
| Compound Name | (2R)-N'-fluoro-N,N,N',2-tetramethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 164861996 |
| Molecular Formula | C7H17FN2 |
| Molecular Weight | 148.22 g/mol |
| Exact Mass | 148.14 |
| IUPAC Name | (2R)-N'-fluoro-N,N,N',2-tetramethylpropane-1,3-diamine |
| SMILES | C[C@H](CN(C)C)CN(C)F |
| InChI | InChI=1S/C7H17FN2/c1-7(5-9(2)3)6-10(4)8/h7H,5-6H2,1-4H3/t7-/m1/s1 |
| InChIKey | SPKFTUVIGXVKLA-SSDOTTSWSA-N |
| XLogP | 1.00 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.22 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|