About CID 164863138
CID 164863138 (PubChem CID 164863138) has the molecular formula C13H10F3O3SSe
and a molecular weight of 382.24 g/mol.
Molecular Properties
| Compound Name | CID 164863138 |
| PubChem CID | 164863138 |
| Molecular Formula | C13H10F3O3SSe |
| Molecular Weight | 382.24 g/mol |
| Exact Mass | 382.95 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O[Se](c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H10F3O3SSe/c14-13(15,16)20(17,18)19-21(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | DWQHLFZVIOPKTO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.24 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze CID 164863138 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164863138?
The IUPAC name of CID 164863138 (CID 164863138) is not available.
What is the SMILES notation for CID 164863138?
The canonical SMILES for CID 164863138 is O=S(=O)(O[Se](c1ccccc1)c1ccccc1)C(F)(F)F.
What is the InChIKey of CID 164863138?
The InChIKey is DWQHLFZVIOPKTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F3O3SSe/c14-13(15,16)20(17,18)19-21(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H.
What are the key properties of CID 164863138?
CID 164863138 has a molecular weight of 382.24 g/mol, XLogP of 1.66, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164863138 is sourced from PubChem (CID 164863138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).