C15H37N — CID 164863401
ethane;2-methylbutane;N,2,4-trimethylpentan-2-amine (PubChem CID 164863401) has the molecular formula C15H37N and a molecular weight of 231.47 g/mol. Its IUPAC name is ethane;2-methylbutane;N,2,4-trimethylpentan-2-amine.
| Compound Name | ethane;2-methylbutane;N,2,4-trimethylpentan-2-amine |
|---|---|
| PubChem CID | 164863401 |
| Molecular Formula | C15H37N |
| Molecular Weight | 231.47 g/mol |
| Exact Mass | 231.29 |
| IUPAC Name | ethane;2-methylbutane;N,2,4-trimethylpentan-2-amine |
| SMILES | CC.CCC(C)C.CNC(C)(C)CC(C)C |
| InChI | InChI=1S/C8H19N.C5H12.C2H6/c1-7(2)6-8(3,4)9-5;1-4-5(2)3;1-2/h7,9H,6H2,1-5H3;5H,4H2,1-3H3;1-2H3 |
| InChIKey | MMGVXMOPDRORPP-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |