About 3,4-dichloro-N-(4-piperazin-1-ylsulfanylphenyl)sulfanyl-1H-indol-7-amine;ethanamine
3,4-dichloro-N-(4-piperazin-1-ylsulfanylphenyl)sulfanyl-1H-indol-7-amine;ethanamine (PubChem CID 164863701) has the molecular formula C20H25Cl2N5S2
and a molecular weight of 470.50 g/mol. Its IUPAC name is 3,4-dichloro-N-(4-piperazin-1-ylsulfanylphenyl)sulfanyl-1H-indol-7-amine;ethanamine.
Molecular Properties
| Compound Name | 3,4-dichloro-N-(4-piperazin-1-ylsulfanylphenyl)sulfanyl-1H-indol-7-amine;ethanamine |
| PubChem CID | 164863701 |
| Molecular Formula | C20H25Cl2N5S2 |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | 3,4-dichloro-N-(4-piperazin-1-ylsulfanylphenyl)sulfanyl-1H-indol-7-amine;ethanamine |
| SMILES | CCN.Clc1ccc(NSc2ccc(SN3CCNCC3)cc2)c2[nH]cc(Cl)c12 |
| InChI | InChI=1S/C18H18Cl2N4S2.C2H7N/c19-14-5-6-16(18-17(14)15(20)11-22-18)23-25-12-1-3-13(4-2-12)26-24-9-7-21-8-10-24;1-2-3/h1-6,11,21-23H,7-10H2;2-3H2,1H3 |
| InChIKey | RUUFGSOEBVIVKU-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dichloro-N-(4-piperazin-1-ylsulfanylphenyl)sulfanyl-1H-indol-7-amine;ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dichloro-N-(4-piperazin-1-ylsulfanylphenyl)sulfanyl-1H-indol-7-amine;ethanamine?
The IUPAC name of 3,4-dichloro-N-(4-piperazin-1-ylsulfanylphenyl)sulfanyl-1H-indol-7-amine;ethanamine (CID 164863701) is 3,4-dichloro-N-(4-piperazin-1-ylsulfanylphenyl)sulfanyl-1H-indol-7-amine;ethanamine.
What is the SMILES notation for 3,4-dichloro-N-(4-piperazin-1-ylsulfanylphenyl)sulfanyl-1H-indol-7-amine;ethanamine?
The canonical SMILES for 3,4-dichloro-N-(4-piperazin-1-ylsulfanylphenyl)sulfanyl-1H-indol-7-amine;ethanamine is CCN.Clc1ccc(NSc2ccc(SN3CCNCC3)cc2)c2[nH]cc(Cl)c12.
What is the InChIKey of 3,4-dichloro-N-(4-piperazin-1-ylsulfanylphenyl)sulfanyl-1H-indol-7-amine;ethanamine?
The InChIKey is RUUFGSOEBVIVKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18Cl2N4S2.C2H7N/c19-14-5-6-16(18-17(14)15(20)11-22-18)23-25-12-1-3-13(4-2-12)26-24-9-7-21-8-10-24;1-2-3/h1-6,11,21-23H,7-10H2;2-3H2,1H3.
What are the key properties of 3,4-dichloro-N-(4-piperazin-1-ylsulfanylphenyl)sulfanyl-1H-indol-7-amine;ethanamine?
3,4-dichloro-N-(4-piperazin-1-ylsulfanylphenyl)sulfanyl-1H-indol-7-amine;ethanamine has a molecular weight of 470.50 g/mol, XLogP of 5.47, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dichloro-N-(4-piperazin-1-ylsulfanylphenyl)sulfanyl-1H-indol-7-amine;ethanamine is sourced from PubChem (CID 164863701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).