About ethane;6-(2-fluorophenyl)-4H-pyrazolo[1,5-a][1,4]benzodiazepine-3-carboxylic acid
ethane;6-(2-fluorophenyl)-4H-pyrazolo[1,5-a][1,4]benzodiazepine-3-carboxylic acid (PubChem CID 164864021) has the molecular formula C20H18FN3O2
and a molecular weight of 351.38 g/mol. Its IUPAC name is ethane;6-(2-fluorophenyl)-4H-pyrazolo[1,5-a][1,4]benzodiazepine-3-carboxylic acid.
Molecular Properties
| Compound Name | ethane;6-(2-fluorophenyl)-4H-pyrazolo[1,5-a][1,4]benzodiazepine-3-carboxylic acid |
| PubChem CID | 164864021 |
| Molecular Formula | C20H18FN3O2 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | ethane;6-(2-fluorophenyl)-4H-pyrazolo[1,5-a][1,4]benzodiazepine-3-carboxylic acid |
| SMILES | CC.O=C(O)c1cnn2c1CN=C(c1ccccc1F)c1ccccc1-2 |
| InChI | InChI=1S/C18H12FN3O2.C2H6/c19-14-7-3-1-5-11(14)17-12-6-2-4-8-15(12)22-16(10-20-17)13(9-21-22)18(23)24;1-2/h1-9H,10H2,(H,23,24);1-2H3 |
| InChIKey | SOPXPGKQONFRLB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;6-(2-fluorophenyl)-4H-pyrazolo[1,5-a][1,4]benzodiazepine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-(2-fluorophenyl)-4H-pyrazolo[1,5-a][1,4]benzodiazepine-3-carboxylic acid?
The IUPAC name of ethane;6-(2-fluorophenyl)-4H-pyrazolo[1,5-a][1,4]benzodiazepine-3-carboxylic acid (CID 164864021) is ethane;6-(2-fluorophenyl)-4H-pyrazolo[1,5-a][1,4]benzodiazepine-3-carboxylic acid.
What is the SMILES notation for ethane;6-(2-fluorophenyl)-4H-pyrazolo[1,5-a][1,4]benzodiazepine-3-carboxylic acid?
The canonical SMILES for ethane;6-(2-fluorophenyl)-4H-pyrazolo[1,5-a][1,4]benzodiazepine-3-carboxylic acid is CC.O=C(O)c1cnn2c1CN=C(c1ccccc1F)c1ccccc1-2.
What is the InChIKey of ethane;6-(2-fluorophenyl)-4H-pyrazolo[1,5-a][1,4]benzodiazepine-3-carboxylic acid?
The InChIKey is SOPXPGKQONFRLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12FN3O2.C2H6/c19-14-7-3-1-5-11(14)17-12-6-2-4-8-15(12)22-16(10-20-17)13(9-21-22)18(23)24;1-2/h1-9H,10H2,(H,23,24);1-2H3.
What are the key properties of ethane;6-(2-fluorophenyl)-4H-pyrazolo[1,5-a][1,4]benzodiazepine-3-carboxylic acid?
ethane;6-(2-fluorophenyl)-4H-pyrazolo[1,5-a][1,4]benzodiazepine-3-carboxylic acid has a molecular weight of 351.38 g/mol, XLogP of 4.09, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-(2-fluorophenyl)-4H-pyrazolo[1,5-a][1,4]benzodiazepine-3-carboxylic acid is sourced from PubChem (CID 164864021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).