C18H29N3O4 — CID 164864860
tert-butyl N-[4,4-diethyl-1-[[(1S)-2-formylcyclopropyl]methyl]-6-oxo-5H-pyrimidin-2-yl]carbamate (PubChem CID 164864860) has the molecular formula C18H29N3O4 and a molecular weight of 351.45 g/mol. Its IUPAC name is tert-butyl N-[4,4-diethyl-1-[[(1S)-2-formylcyclopropyl]methyl]-6-oxo-5H-pyrimidin-2-yl]carbamate.
| Compound Name | tert-butyl N-[4,4-diethyl-1-[[(1S)-2-formylcyclopropyl]methyl]-6-oxo-5H-pyrimidin-2-yl]carbamate |
|---|---|
| PubChem CID | 164864860 |
| Molecular Formula | C18H29N3O4 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | tert-butyl N-[4,4-diethyl-1-[[(1S)-2-formylcyclopropyl]methyl]-6-oxo-5H-pyrimidin-2-yl]carbamate |
| SMILES | CCC1(CC)CC(=O)N(C[C@H]2CC2C=O)C(NC(=O)OC(C)(C)C)=N1 |
| InChI | InChI=1S/C18H29N3O4/c1-6-18(7-2)9-14(23)21(10-12-8-13(12)11-22)15(20-18)19-16(24)25-17(3,4)5/h11-13H,6-10H2,1-5H3,(H,19,20,24)/t12-,13?/m1/s1 |
| InChIKey | IXBRFFQGYGHCCD-PZORYLMUSA-N |
| XLogP | 2.49 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|