C27H40N4O4 — CID 164865013
2-[(1R)-1-(2-amino-4,4-dimethyl-6-oxo-5H-pyrimidin-1-yl)-3-methoxypropyl]-N-[(4S)-2,2,6,7-tetramethyl-3,4-dihydrochromen-4-yl]cyclopropane-1-carboxamide (PubChem CID 164865013) has the molecular formula C27H40N4O4 and a molecular weight of 484.64 g/mol. Its IUPAC name is 2-[(1R)-1-(2-amino-4,4-dimethyl-6-oxo-5H-pyrimidin-1-yl)-3-methoxypropyl]-N-[(4S)-2,2,6,7-tetramethyl-3,4-dihydrochromen-4-yl]cyclopropane-1-carboxamide.
| Compound Name | 2-[(1R)-1-(2-amino-4,4-dimethyl-6-oxo-5H-pyrimidin-1-yl)-3-methoxypropyl]-N-[(4S)-2,2,6,7-tetramethyl-3,4-dihydrochromen-4-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 164865013 |
| Molecular Formula | C27H40N4O4 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | 2-[(1R)-1-(2-amino-4,4-dimethyl-6-oxo-5H-pyrimidin-1-yl)-3-methoxypropyl]-N-[(4S)-2,2,6,7-tetramethyl-3,4-dihydrochromen-4-yl]cyclopropane-1-carboxamide |
| SMILES | COCC[C@H](C1CC1C(=O)N[C@H]1CC(C)(C)Oc2cc(C)c(C)cc21)N1C(=O)CC(C)(C)N=C1N |
| InChI | InChI=1S/C27H40N4O4/c1-15-10-19-20(13-27(5,6)35-22(19)11-16(15)2)29-24(33)18-12-17(18)21(8-9-34-7)31-23(32)14-26(3,4)30-25(31)28/h10-11,17-18,20-21H,8-9,12-14H2,1-7H3,(H2,28,30)(H,29,33)/t17?,18?,20-,21+/m0/s1 |
| InChIKey | QILMDZSWSCDDNU-RRIIRSAJSA-N |
| XLogP | 3.39 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |