About 4-[[(Z)-but-2-enylidene]amino]-3-ethyl-1,2-dihydropyrrol-5-one
4-[[(Z)-but-2-enylidene]amino]-3-ethyl-1,2-dihydropyrrol-5-one (PubChem CID 164865323) has the molecular formula C10H14N2O
and a molecular weight of 178.24 g/mol. Its IUPAC name is 4-[[(Z)-but-2-enylidene]amino]-3-ethyl-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | 4-[[(Z)-but-2-enylidene]amino]-3-ethyl-1,2-dihydropyrrol-5-one |
| PubChem CID | 164865323 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 4-[[(Z)-but-2-enylidene]amino]-3-ethyl-1,2-dihydropyrrol-5-one |
| SMILES | C/C=C\C=N\C1=C(CC)CNC1=O |
| InChI | InChI=1S/C10H14N2O/c1-3-5-6-11-9-8(4-2)7-12-10(9)13/h3,5-6H,4,7H2,1-2H3,(H,12,13)/b5-3-,11-6+ |
| InChIKey | QTEJCGXOBFKWMY-GGKXIICKSA-N |
| XLogP | 1.43 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(Z)-but-2-enylidene]amino]-3-ethyl-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(Z)-but-2-enylidene]amino]-3-ethyl-1,2-dihydropyrrol-5-one?
The IUPAC name of 4-[[(Z)-but-2-enylidene]amino]-3-ethyl-1,2-dihydropyrrol-5-one (CID 164865323) is 4-[[(Z)-but-2-enylidene]amino]-3-ethyl-1,2-dihydropyrrol-5-one.
What is the SMILES notation for 4-[[(Z)-but-2-enylidene]amino]-3-ethyl-1,2-dihydropyrrol-5-one?
The canonical SMILES for 4-[[(Z)-but-2-enylidene]amino]-3-ethyl-1,2-dihydropyrrol-5-one is C/C=C\C=N\C1=C(CC)CNC1=O.
What is the InChIKey of 4-[[(Z)-but-2-enylidene]amino]-3-ethyl-1,2-dihydropyrrol-5-one?
The InChIKey is QTEJCGXOBFKWMY-GGKXIICKSA-N. The full InChI is InChI=1S/C10H14N2O/c1-3-5-6-11-9-8(4-2)7-12-10(9)13/h3,5-6H,4,7H2,1-2H3,(H,12,13)/b5-3-,11-6+.
What are the key properties of 4-[[(Z)-but-2-enylidene]amino]-3-ethyl-1,2-dihydropyrrol-5-one?
4-[[(Z)-but-2-enylidene]amino]-3-ethyl-1,2-dihydropyrrol-5-one has a molecular weight of 178.24 g/mol, XLogP of 1.43, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(Z)-but-2-enylidene]amino]-3-ethyl-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 164865323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).