About 1-(1-piperidin-4-ylpiperidin-4-yl)propan-2-ol;propan-2-ol
1-(1-piperidin-4-ylpiperidin-4-yl)propan-2-ol;propan-2-ol (PubChem CID 164865480) has the molecular formula C16H34N2O2
and a molecular weight of 286.46 g/mol. Its IUPAC name is 1-(1-piperidin-4-ylpiperidin-4-yl)propan-2-ol;propan-2-ol.
Molecular Properties
| Compound Name | 1-(1-piperidin-4-ylpiperidin-4-yl)propan-2-ol;propan-2-ol |
| PubChem CID | 164865480 |
| Molecular Formula | C16H34N2O2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.26 |
| IUPAC Name | 1-(1-piperidin-4-ylpiperidin-4-yl)propan-2-ol;propan-2-ol |
| SMILES | CC(C)O.CC(O)CC1CCN(C2CCNCC2)CC1 |
| InChI | InChI=1S/C13H26N2O.C3H8O/c1-11(16)10-12-4-8-15(9-5-12)13-2-6-14-7-3-13;1-3(2)4/h11-14,16H,2-10H2,1H3;3-4H,1-2H3 |
| InChIKey | GYBMCYQAPMTAIX-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1-piperidin-4-ylpiperidin-4-yl)propan-2-ol;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-piperidin-4-ylpiperidin-4-yl)propan-2-ol;propan-2-ol?
The IUPAC name of 1-(1-piperidin-4-ylpiperidin-4-yl)propan-2-ol;propan-2-ol (CID 164865480) is 1-(1-piperidin-4-ylpiperidin-4-yl)propan-2-ol;propan-2-ol.
What is the SMILES notation for 1-(1-piperidin-4-ylpiperidin-4-yl)propan-2-ol;propan-2-ol?
The canonical SMILES for 1-(1-piperidin-4-ylpiperidin-4-yl)propan-2-ol;propan-2-ol is CC(C)O.CC(O)CC1CCN(C2CCNCC2)CC1.
What is the InChIKey of 1-(1-piperidin-4-ylpiperidin-4-yl)propan-2-ol;propan-2-ol?
The InChIKey is GYBMCYQAPMTAIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O.C3H8O/c1-11(16)10-12-4-8-15(9-5-12)13-2-6-14-7-3-13;1-3(2)4/h11-14,16H,2-10H2,1H3;3-4H,1-2H3.
What are the key properties of 1-(1-piperidin-4-ylpiperidin-4-yl)propan-2-ol;propan-2-ol?
1-(1-piperidin-4-ylpiperidin-4-yl)propan-2-ol;propan-2-ol has a molecular weight of 286.46 g/mol, XLogP of 1.61, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-piperidin-4-ylpiperidin-4-yl)propan-2-ol;propan-2-ol is sourced from PubChem (CID 164865480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).