About methyl 2-[(4-oxopyrido[4,3-d]pyrimidin-3-yl)methyl]-1-benzofuran-7-carboxylate
methyl 2-[(4-oxopyrido[4,3-d]pyrimidin-3-yl)methyl]-1-benzofuran-7-carboxylate (PubChem CID 164866425) has the molecular formula C18H13N3O4
and a molecular weight of 335.32 g/mol. Its IUPAC name is methyl 2-[(4-oxopyrido[4,3-d]pyrimidin-3-yl)methyl]-1-benzofuran-7-carboxylate.
Molecular Properties
| Compound Name | methyl 2-[(4-oxopyrido[4,3-d]pyrimidin-3-yl)methyl]-1-benzofuran-7-carboxylate |
| PubChem CID | 164866425 |
| Molecular Formula | C18H13N3O4 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | methyl 2-[(4-oxopyrido[4,3-d]pyrimidin-3-yl)methyl]-1-benzofuran-7-carboxylate |
| SMILES | COC(=O)c1cccc2cc(Cn3cnc4ccncc4c3=O)oc12 |
| InChI | InChI=1S/C18H13N3O4/c1-24-18(23)13-4-2-3-11-7-12(25-16(11)13)9-21-10-20-15-5-6-19-8-14(15)17(21)22/h2-8,10H,9H2,1H3 |
| InChIKey | VLPYMOIPVWEULC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 87.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-[(4-oxopyrido[4,3-d]pyrimidin-3-yl)methyl]-1-benzofuran-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(4-oxopyrido[4,3-d]pyrimidin-3-yl)methyl]-1-benzofuran-7-carboxylate?
The IUPAC name of methyl 2-[(4-oxopyrido[4,3-d]pyrimidin-3-yl)methyl]-1-benzofuran-7-carboxylate (CID 164866425) is methyl 2-[(4-oxopyrido[4,3-d]pyrimidin-3-yl)methyl]-1-benzofuran-7-carboxylate.
What is the SMILES notation for methyl 2-[(4-oxopyrido[4,3-d]pyrimidin-3-yl)methyl]-1-benzofuran-7-carboxylate?
The canonical SMILES for methyl 2-[(4-oxopyrido[4,3-d]pyrimidin-3-yl)methyl]-1-benzofuran-7-carboxylate is COC(=O)c1cccc2cc(Cn3cnc4ccncc4c3=O)oc12.
What is the InChIKey of methyl 2-[(4-oxopyrido[4,3-d]pyrimidin-3-yl)methyl]-1-benzofuran-7-carboxylate?
The InChIKey is VLPYMOIPVWEULC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N3O4/c1-24-18(23)13-4-2-3-11-7-12(25-16(11)13)9-21-10-20-15-5-6-19-8-14(15)17(21)22/h2-8,10H,9H2,1H3.
What are the key properties of methyl 2-[(4-oxopyrido[4,3-d]pyrimidin-3-yl)methyl]-1-benzofuran-7-carboxylate?
methyl 2-[(4-oxopyrido[4,3-d]pyrimidin-3-yl)methyl]-1-benzofuran-7-carboxylate has a molecular weight of 335.32 g/mol, XLogP of 2.37, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(4-oxopyrido[4,3-d]pyrimidin-3-yl)methyl]-1-benzofuran-7-carboxylate is sourced from PubChem (CID 164866425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).