C21H14F6N2O4 — CID 164866508
1,1,1,3,3,3-hexafluoropropan-2-yl 2-[(1-oxo-3,4-dihydro-2,7-naphthyridin-2-yl)methyl]-1-benzofuran-7-carboxylate (PubChem CID 164866508) has the molecular formula C21H14F6N2O4 and a molecular weight of 472.34 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[(1-oxo-3,4-dihydro-2,7-naphthyridin-2-yl)methyl]-1-benzofuran-7-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[(1-oxo-3,4-dihydro-2,7-naphthyridin-2-yl)methyl]-1-benzofuran-7-carboxylate |
|---|---|
| PubChem CID | 164866508 |
| Molecular Formula | C21H14F6N2O4 |
| Molecular Weight | 472.34 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[(1-oxo-3,4-dihydro-2,7-naphthyridin-2-yl)methyl]-1-benzofuran-7-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)c1cccc2cc(CN3CCc4ccncc4C3=O)oc12 |
| InChI | InChI=1S/C21H14F6N2O4/c22-20(23,24)19(21(25,26)27)33-18(31)14-3-1-2-12-8-13(32-16(12)14)10-29-7-5-11-4-6-28-9-15(11)17(29)30/h1-4,6,8-9,19H,5,7,10H2 |
| InChIKey | IHQVGQRKLUAOFA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.34 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |