About 3-chloro-2-[(pyrazolo[1,5-a]pyrimidine-3-carbonylamino)methyl]-1-benzofuran-7-carboxylic acid
3-chloro-2-[(pyrazolo[1,5-a]pyrimidine-3-carbonylamino)methyl]-1-benzofuran-7-carboxylic acid (PubChem CID 164866679) has the molecular formula C17H11ClN4O4
and a molecular weight of 370.75 g/mol. Its IUPAC name is 3-chloro-2-[(pyrazolo[1,5-a]pyrimidine-3-carbonylamino)methyl]-1-benzofuran-7-carboxylic acid.
Molecular Properties
| Compound Name | 3-chloro-2-[(pyrazolo[1,5-a]pyrimidine-3-carbonylamino)methyl]-1-benzofuran-7-carboxylic acid |
| PubChem CID | 164866679 |
| Molecular Formula | C17H11ClN4O4 |
| Molecular Weight | 370.75 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 3-chloro-2-[(pyrazolo[1,5-a]pyrimidine-3-carbonylamino)methyl]-1-benzofuran-7-carboxylic acid |
| SMILES | O=C(O)c1cccc2c(Cl)c(CNC(=O)c3cnn4cccnc34)oc12 |
| InChI | InChI=1S/C17H11ClN4O4/c18-13-9-3-1-4-10(17(24)25)14(9)26-12(13)8-20-16(23)11-7-21-22-6-2-5-19-15(11)22/h1-7H,8H2,(H,20,23)(H,24,25) |
| InChIKey | HHTSIWUTEYRKSI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 109.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.75 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-chloro-2-[(pyrazolo[1,5-a]pyrimidine-3-carbonylamino)methyl]-1-benzofuran-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-[(pyrazolo[1,5-a]pyrimidine-3-carbonylamino)methyl]-1-benzofuran-7-carboxylic acid?
The IUPAC name of 3-chloro-2-[(pyrazolo[1,5-a]pyrimidine-3-carbonylamino)methyl]-1-benzofuran-7-carboxylic acid (CID 164866679) is 3-chloro-2-[(pyrazolo[1,5-a]pyrimidine-3-carbonylamino)methyl]-1-benzofuran-7-carboxylic acid.
What is the SMILES notation for 3-chloro-2-[(pyrazolo[1,5-a]pyrimidine-3-carbonylamino)methyl]-1-benzofuran-7-carboxylic acid?
The canonical SMILES for 3-chloro-2-[(pyrazolo[1,5-a]pyrimidine-3-carbonylamino)methyl]-1-benzofuran-7-carboxylic acid is O=C(O)c1cccc2c(Cl)c(CNC(=O)c3cnn4cccnc34)oc12.
What is the InChIKey of 3-chloro-2-[(pyrazolo[1,5-a]pyrimidine-3-carbonylamino)methyl]-1-benzofuran-7-carboxylic acid?
The InChIKey is HHTSIWUTEYRKSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11ClN4O4/c18-13-9-3-1-4-10(17(24)25)14(9)26-12(13)8-20-16(23)11-7-21-22-6-2-5-19-15(11)22/h1-7H,8H2,(H,20,23)(H,24,25).
What are the key properties of 3-chloro-2-[(pyrazolo[1,5-a]pyrimidine-3-carbonylamino)methyl]-1-benzofuran-7-carboxylic acid?
3-chloro-2-[(pyrazolo[1,5-a]pyrimidine-3-carbonylamino)methyl]-1-benzofuran-7-carboxylic acid has a molecular weight of 370.75 g/mol, XLogP of 2.76, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-[(pyrazolo[1,5-a]pyrimidine-3-carbonylamino)methyl]-1-benzofuran-7-carboxylic acid is sourced from PubChem (CID 164866679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).