About ethane;2-methylspiro[3.5]nonane
ethane;2-methylspiro[3.5]nonane (PubChem CID 164868147) has the molecular formula C12H24
and a molecular weight of 168.32 g/mol. Its IUPAC name is ethane;2-methylspiro[3.5]nonane.
Molecular Properties
| Compound Name | ethane;2-methylspiro[3.5]nonane |
| PubChem CID | 164868147 |
| Molecular Formula | C12H24 |
| Molecular Weight | 168.32 g/mol |
| Exact Mass | 168.19 |
| IUPAC Name | ethane;2-methylspiro[3.5]nonane |
| SMILES | CC.CC1CC2(CCCCC2)C1 |
| InChI | InChI=1S/C10H18.C2H6/c1-9-7-10(8-9)5-3-2-4-6-10;1-2/h9H,2-8H2,1H3;1-2H3 |
| InChIKey | PFTOKSICQJHZIO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.32 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;2-methylspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylspiro[3.5]nonane?
The IUPAC name of ethane;2-methylspiro[3.5]nonane (CID 164868147) is ethane;2-methylspiro[3.5]nonane.
What is the SMILES notation for ethane;2-methylspiro[3.5]nonane?
The canonical SMILES for ethane;2-methylspiro[3.5]nonane is CC.CC1CC2(CCCCC2)C1.
What is the InChIKey of ethane;2-methylspiro[3.5]nonane?
The InChIKey is PFTOKSICQJHZIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18.C2H6/c1-9-7-10(8-9)5-3-2-4-6-10;1-2/h9H,2-8H2,1H3;1-2H3.
What are the key properties of ethane;2-methylspiro[3.5]nonane?
ethane;2-methylspiro[3.5]nonane has a molecular weight of 168.32 g/mol, XLogP of 4.39, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylspiro[3.5]nonane is sourced from PubChem (CID 164868147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).