C34H40FN7O4 — CID 164869992
[1-[4-[3-fluoro-4-[[7-methoxy-6-[(1-methylpiperidin-4-yl)amino]quinazolin-4-yl]amino]phenoxy]-2-pyridinyl]pyrrolidin-3-yl]methanol;prop-2-enal (PubChem CID 164869992) has the molecular formula C34H40FN7O4 and a molecular weight of 629.74 g/mol. Its IUPAC name is [1-[4-[3-fluoro-4-[[7-methoxy-6-[(1-methylpiperidin-4-yl)amino]quinazolin-4-yl]amino]phenoxy]-2-pyridinyl]pyrrolidin-3-yl]methanol;prop-2-enal.
| Compound Name | [1-[4-[3-fluoro-4-[[7-methoxy-6-[(1-methylpiperidin-4-yl)amino]quinazolin-4-yl]amino]phenoxy]-2-pyridinyl]pyrrolidin-3-yl]methanol;prop-2-enal |
|---|---|
| PubChem CID | 164869992 |
| Molecular Formula | C34H40FN7O4 |
| Molecular Weight | 629.74 g/mol |
| Exact Mass | 629.31 |
| IUPAC Name | [1-[4-[3-fluoro-4-[[7-methoxy-6-[(1-methylpiperidin-4-yl)amino]quinazolin-4-yl]amino]phenoxy]-2-pyridinyl]pyrrolidin-3-yl]methanol;prop-2-enal |
| SMILES | C=CC=O.COc1cc2ncnc(Nc3ccc(Oc4ccnc(N5CCC(CO)C5)c4)cc3F)c2cc1NC1CCN(C)CC1 |
| InChI | InChI=1S/C31H36FN7O3.C3H4O/c1-38-10-7-21(8-11-38)36-28-15-24-27(16-29(28)41-2)34-19-35-31(24)37-26-4-3-22(13-25(26)32)42-23-5-9-33-30(14-23)39-12-6-20(17-39)18-40;1-2-3-4/h3-5,9,13-16,19-21,36,40H,6-8,10-12,17-18H2,1-2H3,(H,34,35,37);2-3H,1H2 |
| InChIKey | OOEQLCJOLDCNPH-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 124.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.74 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|