About ethane;methanol;2-methyl-1H-pyrrolo[2,3-c]pyridine
ethane;methanol;2-methyl-1H-pyrrolo[2,3-c]pyridine (PubChem CID 164870477) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is ethane;methanol;2-methyl-1H-pyrrolo[2,3-c]pyridine.
Molecular Properties
| Compound Name | ethane;methanol;2-methyl-1H-pyrrolo[2,3-c]pyridine |
| PubChem CID | 164870477 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | ethane;methanol;2-methyl-1H-pyrrolo[2,3-c]pyridine |
| SMILES | CC.CO.Cc1cc2ccncc2[nH]1 |
| InChI | InChI=1S/C8H8N2.C2H6.CH4O/c1-6-4-7-2-3-9-5-8(7)10-6;2*1-2/h2-5,10H,1H3;1-2H3;2H,1H3 |
| InChIKey | DSZFFNZDEULQAG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;methanol;2-methyl-1H-pyrrolo[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methanol;2-methyl-1H-pyrrolo[2,3-c]pyridine?
The IUPAC name of ethane;methanol;2-methyl-1H-pyrrolo[2,3-c]pyridine (CID 164870477) is ethane;methanol;2-methyl-1H-pyrrolo[2,3-c]pyridine.
What is the SMILES notation for ethane;methanol;2-methyl-1H-pyrrolo[2,3-c]pyridine?
The canonical SMILES for ethane;methanol;2-methyl-1H-pyrrolo[2,3-c]pyridine is CC.CO.Cc1cc2ccncc2[nH]1.
What is the InChIKey of ethane;methanol;2-methyl-1H-pyrrolo[2,3-c]pyridine?
The InChIKey is DSZFFNZDEULQAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2.C2H6.CH4O/c1-6-4-7-2-3-9-5-8(7)10-6;2*1-2/h2-5,10H,1H3;1-2H3;2H,1H3.
What are the key properties of ethane;methanol;2-methyl-1H-pyrrolo[2,3-c]pyridine?
ethane;methanol;2-methyl-1H-pyrrolo[2,3-c]pyridine has a molecular weight of 194.28 g/mol, XLogP of 2.51, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methanol;2-methyl-1H-pyrrolo[2,3-c]pyridine is sourced from PubChem (CID 164870477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).