C30H34ClFN6O3Si — CID 164870518
2-[[6-[5-chloro-3-[1-(oxan-2-yl)pyrazol-4-yl]quinoxalin-6-yl]oxy-7-fluoro-2-methylbenzimidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 164870518) has the molecular formula C30H34ClFN6O3Si and a molecular weight of 609.18 g/mol. Its IUPAC name is 2-[[6-[5-chloro-3-[1-(oxan-2-yl)pyrazol-4-yl]quinoxalin-6-yl]oxy-7-fluoro-2-methylbenzimidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[6-[5-chloro-3-[1-(oxan-2-yl)pyrazol-4-yl]quinoxalin-6-yl]oxy-7-fluoro-2-methylbenzimidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 164870518 |
| Molecular Formula | C30H34ClFN6O3Si |
| Molecular Weight | 609.18 g/mol |
| Exact Mass | 608.21 |
| IUPAC Name | 2-[[6-[5-chloro-3-[1-(oxan-2-yl)pyrazol-4-yl]quinoxalin-6-yl]oxy-7-fluoro-2-methylbenzimidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1nc2ccc(Oc3ccc4ncc(-c5cnn(C6CCCCO6)c5)nc4c3Cl)c(F)c2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C30H34ClFN6O3Si/c1-19-35-22-9-11-25(28(32)30(22)37(19)18-39-13-14-42(2,3)4)41-24-10-8-21-29(27(24)31)36-23(16-33-21)20-15-34-38(17-20)26-7-5-6-12-40-26/h8-11,15-17,26H,5-7,12-14,18H2,1-4H3 |
| InChIKey | WODUFXBYAGCAPQ-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 89.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.18 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|