C30H33F2IN6O2Si — CID 164870589
2-[[5-[3-[1-[(3,3-difluorocyclobutyl)methyl]pyrazol-4-yl]-5-iodoquinoxalin-6-yl]oxy-2-methylbenzimidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 164870589) has the molecular formula C30H33F2IN6O2Si and a molecular weight of 702.62 g/mol. Its IUPAC name is 2-[[5-[3-[1-[(3,3-difluorocyclobutyl)methyl]pyrazol-4-yl]-5-iodoquinoxalin-6-yl]oxy-2-methylbenzimidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-[3-[1-[(3,3-difluorocyclobutyl)methyl]pyrazol-4-yl]-5-iodoquinoxalin-6-yl]oxy-2-methylbenzimidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 164870589 |
| Molecular Formula | C30H33F2IN6O2Si |
| Molecular Weight | 702.62 g/mol |
| Exact Mass | 702.14 |
| IUPAC Name | 2-[[5-[3-[1-[(3,3-difluorocyclobutyl)methyl]pyrazol-4-yl]-5-iodoquinoxalin-6-yl]oxy-2-methylbenzimidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1nc2cc(Oc3ccc4ncc(-c5cnn(CC6CC(F)(F)C6)c5)nc4c3I)ccc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C30H33F2IN6O2Si/c1-19-36-24-11-22(5-7-26(24)39(19)18-40-9-10-42(2,3)4)41-27-8-6-23-29(28(27)33)37-25(15-34-23)21-14-35-38(17-21)16-20-12-30(31,32)13-20/h5-8,11,14-15,17,20H,9-10,12-13,16,18H2,1-4H3 |
| InChIKey | NVWWRLVZDDCIRH-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 79.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.62 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|