C33H41ClN6O2SSi — CID 164870777
2-[[6-[5-chloro-3-[1-[(4-methylsulfanylcyclohexyl)methyl]pyrazol-4-yl]quinoxalin-6-yl]oxy-2-methylbenzimidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 164870777) has the molecular formula C33H41ClN6O2SSi and a molecular weight of 649.34 g/mol. Its IUPAC name is 2-[[6-[5-chloro-3-[1-[(4-methylsulfanylcyclohexyl)methyl]pyrazol-4-yl]quinoxalin-6-yl]oxy-2-methylbenzimidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[6-[5-chloro-3-[1-[(4-methylsulfanylcyclohexyl)methyl]pyrazol-4-yl]quinoxalin-6-yl]oxy-2-methylbenzimidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 164870777 |
| Molecular Formula | C33H41ClN6O2SSi |
| Molecular Weight | 649.34 g/mol |
| Exact Mass | 648.25 |
| IUPAC Name | 2-[[6-[5-chloro-3-[1-[(4-methylsulfanylcyclohexyl)methyl]pyrazol-4-yl]quinoxalin-6-yl]oxy-2-methylbenzimidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CSC1CCC(Cn2cc(-c3cnc4ccc(Oc5ccc6nc(C)n(COCC[Si](C)(C)C)c6c5)c(Cl)c4n3)cn2)CC1 |
| InChI | InChI=1S/C33H41ClN6O2SSi/c1-22-37-27-11-8-25(16-30(27)40(22)21-41-14-15-44(3,4)5)42-31-13-12-28-33(32(31)34)38-29(18-35-28)24-17-36-39(20-24)19-23-6-9-26(43-2)10-7-23/h8,11-13,16-18,20,23,26H,6-7,9-10,14-15,19,21H2,1-5H3 |
| InChIKey | FOESWJVTDFIWOD-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 79.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.34 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|