C26H25ClN4O2S — CID 164871337
1-[[7-[(1aS,7bR)-6-chloro-3-[(3R)-pyrrolidin-3-yl]-1,1a,2,7b-tetrahydrocyclopropa[c]quinolin-4-yl]thieno[3,2-b]pyridin-2-yl]methyl]pyrrolidine-2,5-dione (PubChem CID 164871337) has the molecular formula C26H25ClN4O2S and a molecular weight of 493.03 g/mol. Its IUPAC name is 1-[[7-[(1aS,7bR)-6-chloro-3-[(3R)-pyrrolidin-3-yl]-1,1a,2,7b-tetrahydrocyclopropa[c]quinolin-4-yl]thieno[3,2-b]pyridin-2-yl]methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[[7-[(1aS,7bR)-6-chloro-3-[(3R)-pyrrolidin-3-yl]-1,1a,2,7b-tetrahydrocyclopropa[c]quinolin-4-yl]thieno[3,2-b]pyridin-2-yl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 164871337 |
| Molecular Formula | C26H25ClN4O2S |
| Molecular Weight | 493.03 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 1-[[7-[(1aS,7bR)-6-chloro-3-[(3R)-pyrrolidin-3-yl]-1,1a,2,7b-tetrahydrocyclopropa[c]quinolin-4-yl]thieno[3,2-b]pyridin-2-yl]methyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1Cc1cc2nccc(-c3cc(Cl)cc4c3N([C@@H]3CCNC3)C[C@H]3C[C@@H]43)c2s1 |
| InChI | InChI=1S/C26H25ClN4O2S/c27-15-8-20(25-21(9-15)19-7-14(19)12-30(25)16-3-5-28-11-16)18-4-6-29-22-10-17(34-26(18)22)13-31-23(32)1-2-24(31)33/h4,6,8-10,14,16,19,28H,1-3,5,7,11-13H2/t14-,16-,19-/m1/s1 |
| InChIKey | QOAYBAYSNGKNLM-IDHHARJASA-N |
| XLogP | 4.55 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.03 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|