About 1-(3,3-difluoropropyl)pyrimidine-2,4-dione
1-(3,3-difluoropropyl)pyrimidine-2,4-dione (PubChem CID 164871461) has the molecular formula C7H8F2N2O2
and a molecular weight of 190.15 g/mol. Its IUPAC name is 1-(3,3-difluoropropyl)pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-(3,3-difluoropropyl)pyrimidine-2,4-dione |
| PubChem CID | 164871461 |
| Molecular Formula | C7H8F2N2O2 |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 1-(3,3-difluoropropyl)pyrimidine-2,4-dione |
| SMILES | O=c1ccn(CCC(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C7H8F2N2O2/c8-5(9)1-3-11-4-2-6(12)10-7(11)13/h2,4-5H,1,3H2,(H,10,12,13) |
| InChIKey | XPPDNDZMKTYOSQ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3,3-difluoropropyl)pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-difluoropropyl)pyrimidine-2,4-dione?
The IUPAC name of 1-(3,3-difluoropropyl)pyrimidine-2,4-dione (CID 164871461) is 1-(3,3-difluoropropyl)pyrimidine-2,4-dione.
What is the SMILES notation for 1-(3,3-difluoropropyl)pyrimidine-2,4-dione?
The canonical SMILES for 1-(3,3-difluoropropyl)pyrimidine-2,4-dione is O=c1ccn(CCC(F)F)c(=O)[nH]1.
What is the InChIKey of 1-(3,3-difluoropropyl)pyrimidine-2,4-dione?
The InChIKey is XPPDNDZMKTYOSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F2N2O2/c8-5(9)1-3-11-4-2-6(12)10-7(11)13/h2,4-5H,1,3H2,(H,10,12,13).
What are the key properties of 1-(3,3-difluoropropyl)pyrimidine-2,4-dione?
1-(3,3-difluoropropyl)pyrimidine-2,4-dione has a molecular weight of 190.15 g/mol, XLogP of 0.19, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-difluoropropyl)pyrimidine-2,4-dione is sourced from PubChem (CID 164871461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).