About 1-(3,3-difluorobutyl)pyrimidine-2,4-dione
1-(3,3-difluorobutyl)pyrimidine-2,4-dione (PubChem CID 164871790) has the molecular formula C8H10F2N2O2
and a molecular weight of 204.18 g/mol. Its IUPAC name is 1-(3,3-difluorobutyl)pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-(3,3-difluorobutyl)pyrimidine-2,4-dione |
| PubChem CID | 164871790 |
| Molecular Formula | C8H10F2N2O2 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 1-(3,3-difluorobutyl)pyrimidine-2,4-dione |
| SMILES | CC(F)(F)CCn1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C8H10F2N2O2/c1-8(9,10)3-5-12-4-2-6(13)11-7(12)14/h2,4H,3,5H2,1H3,(H,11,13,14) |
| InChIKey | VXESFZDUDAXOKH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3,3-difluorobutyl)pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-difluorobutyl)pyrimidine-2,4-dione?
The IUPAC name of 1-(3,3-difluorobutyl)pyrimidine-2,4-dione (CID 164871790) is 1-(3,3-difluorobutyl)pyrimidine-2,4-dione.
What is the SMILES notation for 1-(3,3-difluorobutyl)pyrimidine-2,4-dione?
The canonical SMILES for 1-(3,3-difluorobutyl)pyrimidine-2,4-dione is CC(F)(F)CCn1ccc(=O)[nH]c1=O.
What is the InChIKey of 1-(3,3-difluorobutyl)pyrimidine-2,4-dione?
The InChIKey is VXESFZDUDAXOKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F2N2O2/c1-8(9,10)3-5-12-4-2-6(13)11-7(12)14/h2,4H,3,5H2,1H3,(H,11,13,14).
What are the key properties of 1-(3,3-difluorobutyl)pyrimidine-2,4-dione?
1-(3,3-difluorobutyl)pyrimidine-2,4-dione has a molecular weight of 204.18 g/mol, XLogP of 0.58, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-difluorobutyl)pyrimidine-2,4-dione is sourced from PubChem (CID 164871790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).